Compound Q&A

How is 3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride (CAS: 817169-86-1) typically synthesized?

Answer

3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride
3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride can be synthesized via multi-step processes. A typical method involves the reaction of 4-cyclobutyl-2-oxobutanoyl chloride with an amino-containing compound such as aniline, followed by acidification with hydrochloric acid to form the hydrochloride salt. The reaction requires careful control of pH and temperature to achieve high yield and selectivity.

About

English Name 3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride
Molecular Formula C8H15ClN2O2
Molecular Weight 206.67 g/mol
SMILES Cl.NC(CC1CCC1)C(=O)C(N)=O
InChIKey IYUGMAUQLONHLQ-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride (CAS: 817169-86-1)?

3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride (CAS: 817169-86-1)?

3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride (CAS: 817169-86-1)?

When handling 3-Amino-4-cyclobutyl-2-oxobutanamide hydrochloride, it is important to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...