Compound Q&A

How is (3aR,4R,5R,6aS)-5-Hydroxy-4-[(3S)-3-hydroxy-5-phenyl-1-penten-1-yl]hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 41639-74-1) typically synthesized?

Answer

(3aR,4R,5R,6aS)-5-Hydroxy-4-[(3S)-3-hydroxy-5-phenyl-1-penten-1-yl]hexahydro-2H-cyclopenta[b]furan-2-one
This compound can be synthesized via a multi-step process involving the formation of a cyclopentene derivative followed by a Diels-Alder reaction and subsequent hydroxylation steps. The key reagents include phenylacetylene, crotonaldehyde, and a suitably activated dicarbonyl compound. The overall yield is moderate, and the reaction conditions are carefully controlled to achieve high selectivity.

About

CAS No 41639-74-1
English Name (3aR,4R,5R,6aS)-5-Hydroxy-4-[(3S)-3-hydroxy-5-phenyl-1-penten-1-yl]hexahydro-2H-cyclopenta[b]furan-2-one
Molecular Formula C18H22O4
Molecular Weight 302.37 g/mol
SMILES C1C(C(C2C1OC(=O)C2)C=CC(CCC3=CC=CC=C3)O)O
InChIKey PFIFPUGALHSEKD-UTSKFRMZSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3aR,4R,5R,6aS)-5-Hydroxy-4-[(3S)-3-hydroxy-5-phenyl-1-penten-1-yl]hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 41639-74-1)?

The compound is a white to off-white solid with a molecular weight of approximately 312.32 g/mol. It...

Compound Q&A

What industries use (3aR,4R,5R,6aS)-5-Hydroxy-4-[(3S)-3-hydroxy-5-phenyl-1-penten-1-yl]hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 41639-74-1)?

This compound is primarily used in the pharmaceutical industry as a precursor to drug synthesis. It ...

Compound Q&A

What precautions should be taken when handling (3aR,4R,5R,6aS)-5-Hydroxy-4-[(3S)-3-hydroxy-5-phenyl-1-penten-1-yl]hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 41639-74-1)?

Proper personal protective equipment (PPE) should be worn when handling this compound, including glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...