Compound Q&A

What precautions should be taken when handling 1-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2173555-52-5)?

Answer

1-Bromo-7-chlorodibenzo[b,d]furan
When handling 1-Bromo-7-chlorodibenzo[b,d]furan, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a laboratory coat. The substance should be handled in a well-ventilated area or a fume hood to minimize exposure to volatile compounds. Spills should be cleaned up using appropriate absorbent materials, and proper disposal methods should be followed according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name 1-Bromo-7-chlorodibenzo[b,d]furan
Molecular Formula C12H6BrClO
Molecular Weight 281.54 g/mol
SMILES ClC1=CC=C2C3=C(Br)C=CC=C3OC2=C1
InChIKey WXKGFVXGRJHAML-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2173555-52-5)?

1-Bromo-7-chlorodibenzo[b,d]furan is a crystalline solid with a molecular weight of approximately 31...

Compound Q&A

How is 1-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2173555-52-5) typically synthesized?

1-Bromo-7-chlorodibenzo[b,d]furan can be synthesized through the reaction of 7-chlorodibenzo[b,d]fur...

Compound Q&A

What industries use 1-Bromo-7-chlorodibenzo[b,d]furan (CAS: 2173555-52-5)?

1-Bromo-7-chlorodibenzo[b,d]furan is used in various industries, including pharmaceuticals, where it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...