Compound Q&A

What are the physical and chemical properties of 4-[2-(Trifluoromethyl)phenoxy]piperidine (CAS: 824390-04-7)?

Answer

4-[2-(Trifluoromethyl)phenoxy]piperidine
4-[2-(Trifluoromethyl)phenoxy]piperidine is a white crystalline solid with a molecular weight of approximately 323.14 g/mol. It is slightly soluble in water but soluble in organic solvents such as ethanol and chloroform. Chemically, it is relatively stable but can react with strong acids to form less stable derivatives. The compound has a pKa of around 7.5 and is known for its potent agonist activity at muscarinic receptors.

About

English Name 4-[2-(Trifluoromethyl)phenoxy]piperidine
Molecular Formula C12H14F3NO
Molecular Weight 245.24 g/mol
SMILES C1CNCCC1OC2=CC=CC=C2C(F)(F)F
InChIKey MBZJEIRMMYDAFD-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is 4-[2-(Trifluoromethyl)phenoxy]piperidine (CAS: 824390-04-7) typically synthesized?

4-[2-(Trifluoromethyl)phenoxy]piperidine is synthesized via a multistep procedure involving the prot...

Compound Q&A

What industries use 4-[2-(Trifluoromethyl)phenoxy]piperidine (CAS: 824390-04-7)?

4-[2-(Trifluoromethyl)phenoxy]piperidine is primarily used in the pharmaceutical industry for develo...

Compound Q&A

What precautions should be taken when handling 4-[2-(Trifluoromethyl)phenoxy]piperidine (CAS: 824390-04-7)?

When handling 4-[2-(Trifluoromethyl)phenoxy]piperidine, ensure the use of personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...