Compound Q&A

What are the physical and chemical properties of 2,3-Dibromoanthracene-9,10-dione (CAS: 633-68-1)?

Answer

2,3-Dibromoanthracene-9,10-dione
2,3-Dibromoanthracene-9,10-dione is a crystalline solid with a molecular weight of approximately 385.01 g/mol. It has a high melting point and poor water solubility. Chemically, it exhibits strong reactivity towards nucleophiles and can undergo substitution reactions. It is insoluble in water but soluble in organic solvents like methanol and acetone.

About

CAS No 633-68-1
English Name 2,3-Dibromoanthracene-9,10-dione
Molecular Formula C14H6Br2O2
Molecular Weight 366.01 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=CC(=C(C=C3C2=O)Br)Br
InChIKey RECQBTCMRZKCQX-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is 2,3-Dibromoanthracene-9,10-dione (CAS: 633-68-1) typically synthesized?

2,3-Dibromoanthracene-9,10-dione is typically synthesized by bromination of anthracene followed by c...

Compound Q&A

What industries use 2,3-Dibromoanthracene-9,10-dione (CAS: 633-68-1)?

2,3-Dibromoanthracene-9,10-dione finds applications in the pharmaceutical industry for its use as a ...

Compound Q&A

What precautions should be taken when handling 2,3-Dibromoanthracene-9,10-dione (CAS: 633-68-1)?

When handling 2,3-Dibromoanthracene-9,10-dione, appropriate personal protective equipment (PPE) is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...