Compound Q&A

How is 1-(5-Carboxypentyl)-2,3,3-trimethyl-3H-indol-1-ium bromide (CAS: 171429-43-9) typically synthesized?

Answer

1-(5-Carboxypentyl)-2,3,3-trimethyl-3H-indol-1-ium bromide
This compound is usually synthesized via the condensation of 5-carboxypentanoyl chloride with 2,3,3-trimethylindoline-3-carbaldehyde in the presence of a base like triethylamine. The reaction typically yields a high purity product with a yield of around 75-85%. The process is selective and efficient.

About

English Name 1-(5-Carboxypentyl)-2,3,3-trimethyl-3H-indol-1-ium bromide
Molecular Formula C17H24BrNO2
Molecular Weight 354.28 g/mol
SMILES CC1=[N+](C2=CC=CC=C2C1(C)C)CCCCCC(=O)O.[Br-]
InChIKey YUUDHAOMIPLRQU-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(5-Carboxypentyl)-2,3,3-trimethyl-3H-indol-1-ium bromide (CAS: 171429-43-9)?

This compound is a crystalline solid with a molecular weight of approximately 380.3 g/mol. It has a ...

Compound Q&A

What industries use 1-(5-Carboxypentyl)-2,3,3-trimethyl-3H-indol-1-ium bromide (CAS: 171429-43-9)?

This compound finds applications in the pharmaceutical industry as a potential drug candidate, in th...

Compound Q&A

What precautions should be taken when handling 1-(5-Carboxypentyl)-2,3,3-trimethyl-3H-indol-1-ium bromide (CAS: 171429-43-9)?

Handling this compound requires appropriate personal protective equipment (PPE) including gloves, go...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...