Compound Q&A

What are the physical and chemical properties of 3,6-Dibromo-9-vinyl-9H-carbazole (CAS: 1214-16-0)?

Answer

3,6-Dibromo-9-vinyl-9H-carbazole
3,6-Dibromo-9-vinyl-9H-carbazole is a crystalline solid with a high molecular weight. It has a low solubility in water but is more soluble in organic solvents like chloroform and benzene. Chemically, it is less reactive towards nucleophiles due to the presence of bromine atoms and the vinyl group, making it suitable for specific synthetic applications. It decomposes above 300°C and shows typical carbazole spectral characteristics in UV-Vis and NMR spectroscopy.

About

CAS No 1214-16-0
English Name 3,6-Dibromo-9-vinyl-9H-carbazole
Molecular Formula C14H9Br2N
Molecular Weight 351.04 g/mol
SMILES C=CN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br
InChIKey ORMIJZCMQBMNFA-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is 3,6-Dibromo-9-vinyl-9H-carbazole (CAS: 1214-16-0) typically synthesized?

3,6-Dibromo-9-vinyl-9H-carbazole is typically synthesized via the bromination of 9-vinylcarbazole fo...

Compound Q&A

What industries use 3,6-Dibromo-9-vinyl-9H-carbazole (CAS: 1214-16-0)?

3,6-Dibromo-9-vinyl-9H-carbazole is utilized in various industries, including pharmaceuticals for it...

Compound Q&A

What precautions should be taken when handling 3,6-Dibromo-9-vinyl-9H-carbazole (CAS: 1214-16-0)?

When handling 3,6-Dibromo-9-vinyl-9H-carbazole, it is crucial to wear appropriate Personal Protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...