Compound Q&A

How is (6bR,10aR)-3-Methyl-2,3,6b,7,8,9,10,10a-octahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline (CAS: 313368-85-3) typically synthesized?

Answer

(6bR,10aR)-3-Methyl-2,3,6b,7,8,9,10,10a-octahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline
This compound is synthesized via a multi-step process starting from quinoxaline. Common methods include condensation and cyclization reactions. The key steps involve the formation of a 2,3-dicarbonyl intermediate, followed by cyclization and methylation. The reaction conditions and catalysts can vary, but the overall yield is around 70-80%.

About

English Name (6bR,10aR)-3-Methyl-2,3,6b,7,8,9,10,10a-octahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline
Molecular Formula C14H19N3
Molecular Weight 229.33 g/mol
SMILES CN1CCN2c3c1cccc3[C@H]1[C@@H]2CCNC1
InChIKey QLGUCSLWLPCOTR-RYUDHWBXSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6bR,10aR)-3-Methyl-2,3,6b,7,8,9,10,10a-octahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline (CAS: 313368-85-3)?

This compound is a crystalline solid with a molecular weight of approximately 280.33 g/mol. It has a...

Compound Q&A

What industries use (6bR,10aR)-3-Methyl-2,3,6b,7,8,9,10,10a-octahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline (CAS: 313368-85-3)?

This compound finds applications in the pharmaceutical industry, where it is used as a precursor for...

Compound Q&A

What precautions should be taken when handling (6bR,10aR)-3-Methyl-2,3,6b,7,8,9,10,10a-octahydro-1H-pyrido[3',4':4,5]pyrrolo[1,2,3-de]quinoxaline (CAS: 313368-85-3)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...