Compound Q&A

How is (-)-Praeruptorin B (CAS: 4970-26-7) typically synthesized?

Answer

(-)-Praeruptorin B
(-)-Praeruptorin B (CAS: 4970-26-7) is synthesized through a series of reactions starting from natural precursors. Common methods include semi-synthesis and total synthesis using chemical transformation, such as condensation, reduction, and oxidation, with high selectivity and yield, often employing catalysts like palladium complexes.

About

CAS No 4970-26-7
English Name (-)-Praeruptorin B
Molecular Formula C24H26O7
Molecular Weight 426.46 g/mol
SMILES CC=C(C)C(=O)OC1C(C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)OC(=O)C(=CC)C
InChIKey PNTWXEIQXBRCPS-IOWUNYDSSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of (-)-Praeruptorin B (CAS: 4970-26-7)?

(-)-Praeruptorin B (CAS: 4970-26-7) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use (-)-Praeruptorin B (CAS: 4970-26-7)?

(-)-Praeruptorin B (CAS: 4970-26-7) is used in the pharmaceutical industry for its potential as an a...

Compound Q&A

What precautions should be taken when handling (-)-Praeruptorin B (CAS: 4970-26-7)?

When handling (-)-Praeruptorin B (CAS: 4970-26-7), ensure proper Personal Protective Equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...