Compound Q&A

How is Sennoside (CAS: 517-43-1) typically synthesized?

Answer

Sennoside
Sennoside is synthesized from sennidin, which is extracted from the seeds of the senna plant. The synthesis involves multiple steps, including hydrogenation, acetylation, and oxidation. Typical catalysts used include palladium catalysts, and the overall yield can range from 30% to 50% depending on the method.

About

CAS No 517-43-1
English Name Sennoside
Molecular Formula C42H38O20
Molecular Weight 862.7 g/mol
SMILES C1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C2C5C6=C(C(=CC=C6)OC7C(C(C(C(O7)CO)O)O)O)C(=O)C8=C5C=C(C=C8O)C(=O)O)C=C(C=C4O)C(=O)O
InChIKey IPQVTOJGNYVQEO-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sennoside (CAS: 517-43-1)?

Sennoside, CAS 517-43-1, is a crystalline compound. Its molecular weight is approximately 466.36 g/m...

Compound Q&A

What industries use Sennoside (CAS: 517-43-1)?

Sennoside, CAS 517-43-1, is primarily used in the pharmaceutical industry for its laxative propertie...

Compound Q&A

What precautions should be taken when handling Sennoside (CAS: 517-43-1)?

When handling Sennoside, CAS 517-43-1, it is important to wear appropriate personal protective equip...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...