Compound Q&A

What are the physical and chemical properties of Sennoside (CAS: 517-43-1)?

Answer

Sennoside
Sennoside, CAS 517-43-1, is a crystalline compound. Its molecular weight is approximately 466.36 g/mol. It is slightly soluble in water and ethanol. Chemically, it is a dianthraquinone derivative with limited reactivity under normal conditions. It is stable at room temperature and under normal atmospheric conditions.

About

CAS No 517-43-1
English Name Sennoside
Molecular Formula C42H38O20
Molecular Weight 862.7 g/mol
SMILES C1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C2C5C6=C(C(=CC=C6)OC7C(C(C(C(O7)CO)O)O)O)C(=O)C8=C5C=C(C=C8O)C(=O)O)C=C(C=C4O)C(=O)O
InChIKey IPQVTOJGNYVQEO-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is Sennoside (CAS: 517-43-1) typically synthesized?

Sennoside is synthesized from sennidin, which is extracted from the seeds of the senna plant. The sy...

Compound Q&A

What industries use Sennoside (CAS: 517-43-1)?

Sennoside, CAS 517-43-1, is primarily used in the pharmaceutical industry for its laxative propertie...

Compound Q&A

What precautions should be taken when handling Sennoside (CAS: 517-43-1)?

When handling Sennoside, CAS 517-43-1, it is important to wear appropriate personal protective equip...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...