Compound Q&A

What precautions should be taken when handling Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (CAS: 36965-70-5)?

Answer

Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (1:1:1)
When handling Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (CAS: 36965-70-5), it is important to use proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate spill kits. Always consult the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

CAS No 36965-70-5
English Name Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (1:1:1)
Molecular Formula C44H24Cl5FeN4
Molecular Weight 847.85 g/mol
SMILES ClC1=CC=C(C=C1)C2=C3C=CC4=[N]3[Fe]56(Cl)N7C2=CC=C7C(C8=CC=C(C=C8)Cl)=C(C=C9)[N]5=C9C(C%10=CC=C(C=C%10)Cl)=C%11C=CC(N%116)=C4C%12=CC=C(C=C%12)Cl
InChIKey YEGVMWUNNVFREH-SRSJGESKSA-M
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (CAS: 36965-70-5)?

Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (CAS: 36965-70-5) is a cry...

Compound Q&A

How is Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (CAS: 36965-70-5) typically synthesized?

Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (CAS: 36965-70-5) is synth...

Compound Q&A

What industries use Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (CAS: 36965-70-5)?

Iron(3+) chloride 5,10,15,20-tetrakis(4-chlorophenyl)porphine-21,23-diide (CAS: 36965-70-5) is prima...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...