Compound Q&A

What are the physical and chemical properties of 2,2'-Bi-1H-benzimidazole (CAS: 6965-02-2)?

Answer

2,2'-Bi-1H-benzimidazole
2,2'-Bi-1H-benzimidazole is a white crystalline solid with a molecular weight of approximately 228.22 g/mol. It has a high melting point of around 260°C and is insoluble in water but soluble in organic solvents like ethanol and dimethylformamide. Chemically, it is stable under normal conditions but can react with strong acids and bases. It is used as a starting material in the synthesis of other compounds and as a fluorescent probe.

About

CAS No 6965-02-2
English Name 2,2'-Bi-1H-benzimidazole
Molecular Formula C14H10N4
Molecular Weight 234.26 g/mol
SMILES C1=CC=C2C(=C1)NC(=N2)C3=NC4=CC=CC=C4N3
InChIKey VEZJRJGLFIXQHG-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:33

Related Q&A

Compound Q&A

How is 2,2'-Bi-1H-benzimidazole (CAS: 6965-02-2) typically synthesized?

2,2'-Bi-1H-benzimidazole is synthesized through the coupling of two benzimidazole units via a conden...

Compound Q&A

What industries use 2,2'-Bi-1H-benzimidazole (CAS: 6965-02-2)?

2,2'-Bi-1H-benzimidazole is used in various industries. In pharmaceuticals, it serves as a precursor...

Compound Q&A

What precautions should be taken when handling 2,2'-Bi-1H-benzimidazole (CAS: 6965-02-2)?

When handling 2,2'-Bi-1H-benzimidazole, it is crucial to wear appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...