Compound Q&A

What industries use 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol (CAS: 50428-39-2)?

Answer

2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol
2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol is primarily used in the pharmaceutical and polymer industries. In pharmaceuticals, it serves as a precursor for the synthesis of various drugs. In polymers, it can be used as a monomer to produce high-performance materials. It also finds applications in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 50428-39-2
English Name 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol
Molecular Formula C13H20O
Molecular Weight 72.151 g/mol
SMILES CC(C)(C)C#CC(C#CC(C)(C)C)O
InChIKey KGZASKNUKKURJQ-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol (CAS: 50428-39-2)?

2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol is a colorless solid with a molecular weight of approximately ...

Compound Q&A

How is 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol (CAS: 50428-39-2) typically synthesized?

2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol is usually synthesized by the Wittig reaction starting from me...

Compound Q&A

What precautions should be taken when handling 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol (CAS: 50428-39-2)?

When handling 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol, appropriate personal protective equipment (PPE)...

Compound Q&A

What is the market or research trend for N-Methylphenylalanine (CAS: 2566-30-5)?

The market for N-Methylphenylalanine (CAS: 2566-30-5) is growing due to its appl...

2566-30-5N-Methylphenylalanin...
Compound Q&A

What are the main uses of 4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2)?

4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2) is primarily used in pharma...

210488-53-24-[(1R)-1-Aminoethyl...
Compound Q&A

Is 2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CAS: 110925-92-3) safe?

2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CA...

110925-92-32-Hydroxy-N-{3-[3-(1...
Compound Q&A

What are the physical and chemical properties of 2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5)?

2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5) is a white crystalline solid with ...

169508-94-52-(5-Oxazolyl)benzoi...