Compound Q&A

What are the physical and chemical properties of 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol (CAS: 50428-39-2)?

Answer

2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol
2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol is a colorless solid with a molecular weight of approximately 216.23 g/mol. It has a melting point of 75-77°C and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive, especially towards electrophiles and can undergo various chemical transformations such as addition and substitution reactions.

About

CAS No 50428-39-2
English Name 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol
Molecular Formula C13H20O
Molecular Weight 72.151 g/mol
SMILES CC(C)(C)C#CC(C#CC(C)(C)C)O
InChIKey KGZASKNUKKURJQ-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

How is 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol (CAS: 50428-39-2) typically synthesized?

2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol is usually synthesized by the Wittig reaction starting from me...

Compound Q&A

What industries use 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol (CAS: 50428-39-2)?

2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol is primarily used in the pharmaceutical and polymer industries...

Compound Q&A

What precautions should be taken when handling 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol (CAS: 50428-39-2)?

When handling 2,2,8,8-Tetramethyl-3,6-nonadiyn-5-ol, appropriate personal protective equipment (PPE)...

Compound Q&A

What is the market or research trend for N-Methylphenylalanine (CAS: 2566-30-5)?

The market for N-Methylphenylalanine (CAS: 2566-30-5) is growing due to its appl...

2566-30-5N-Methylphenylalanin...
Compound Q&A

What are the main uses of 4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2)?

4-[(1R)-1-Aminoethyl]benzonitrile (CAS: 210488-53-2) is primarily used in pharma...

210488-53-24-[(1R)-1-Aminoethyl...
Compound Q&A

Is 2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CAS: 110925-92-3) safe?

2-Hydroxy-N-{3-[3-(1-piperidinylmethyl)phenoxy]propyl}acetamide ethanedioate (CA...

110925-92-32-Hydroxy-N-{3-[3-(1...
Compound Q&A

What are the physical and chemical properties of 2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5)?

2-(5-Oxazolyl)benzoic Acid (CAS: 169508-94-5) is a white crystalline solid with ...

169508-94-52-(5-Oxazolyl)benzoi...