Compound Q&A

How is 2-(4-Octylphenyl)ethyl acetate (CAS: 162358-04-5) typically synthesized?

Answer

2-(4-Octylphenyl)ethyl acetate
2-(4-Octylphenyl)ethyl acetate (CAS: 162358-04-5) is synthesized via esterification of 2-(4-octylphenyl)ethanol with acetic acid. Commonly, a phosphoric acid catalyst is used to enhance the reaction rate, and the product is purified by distillation. This method provides good selectivity and high yield.

About

English Name 2-(4-Octylphenyl)ethyl acetate
Molecular Formula C18H28O2
Molecular Weight 276.42 g/mol
SMILES O=C(OCCc1ccc(cc1)CCCCCCCC)C
InChIKey GBRYLJCBBFSRPK-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Octylphenyl)ethyl acetate (CAS: 162358-04-5)?

2-(4-Octylphenyl)ethyl acetate (CAS: 162358-04-5) is a clear, colorless liquid with a higher boiling...

Compound Q&A

What industries use 2-(4-Octylphenyl)ethyl acetate (CAS: 162358-04-5)?

2-(4-Octylphenyl)ethyl acetate (CAS: 162358-04-5) is used in the fragrance and flavor industry, as w...

Compound Q&A

What precautions should be taken when handling 2-(4-Octylphenyl)ethyl acetate (CAS: 162358-04-5)?

When handling 2-(4-Octylphenyl)ethyl acetate (CAS: 162358-04-5), appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...