Compound Q&A

What industries use 4-Cyanophenyl 4-ethylbenzoate (CAS: 56131-48-7)?

Answer

4-Cyanophenyl 4-ethylbenzoate
4-Cyanophenyl 4-ethylbenzoate (CAS: 56131-48-7) is primarily used in the pharmaceutical industry for the development of certain drug molecules. It also finds applications in the synthesis of polymers and sensors. The compound is less common in semiconductor manufacturing but has potential uses in advanced materials due to its unique chemical structure.

About

CAS No 56131-48-7
English Name 4-Cyanophenyl 4-ethylbenzoate
Molecular Formula C16H13NO2
Molecular Weight 240.3 g/mol
SMILES CCC1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)C#N
InChIKey ULFIAHFQEURGOU-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Cyanophenyl 4-ethylbenzoate (CAS: 56131-48-7)?

4-Cyanophenyl 4-ethylbenzoate (CAS: 56131-48-7) is a solid with a crystalline form. It has a molecul...

Compound Q&A

How is 4-Cyanophenyl 4-ethylbenzoate (CAS: 56131-48-7) typically synthesized?

4-Cyanophenyl 4-ethylbenzoate can be synthesized via the acylation of 4-ethylbenzoic acid with a cya...

Compound Q&A

What precautions should be taken when handling 4-Cyanophenyl 4-ethylbenzoate (CAS: 56131-48-7)?

When handling 4-Cyanophenyl 4-ethylbenzoate (CAS: 56131-48-7), it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...