Compound Q&A

How is BODIPY-FL NHS ester (CAS: 146616-66-2) typically synthesized?

Answer

BODIPY-FL NHS ester
BODIPY-FL NHS ester (CAS: 146616-66-2) is typically synthesized by first protecting the BODIPY core with a hydroxyl group, then converting it to an acetylated derivative. This is followed by esterification with NHS ester to yield the final product. Common solvents include dichloromethane, and the reaction proceeds via a nucleophilic substitution mechanism. Yield is generally around 75-85%, and the reaction is catalyzed by a suitable base or acid depending on the specific step.

About

English Name BODIPY-FL NHS ester
Molecular Formula C18H18BF2N3O4
Molecular Weight 389.2 g/mol
SMILES [B-]1(N2C(=CC(=C2C=C3[N+]1=C(C=C3)CCC(=O)ON4C(=O)CCC4=O)C)C)(F)F
InChIKey SDVMGNSTOAJONW-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of BODIPY-FL NHS ester (CAS: 146616-66-2)?

BODIPY-FL NHS ester (CAS: 146616-66-2) is a water-insoluble, orange-fluorescent compound. It has a m...

Compound Q&A

What industries use BODIPY-FL NHS ester (CAS: 146616-66-2)?

BODIPY-FL NHS ester (CAS: 146616-66-2) is widely used in pharmaceutical, biotechnology, and chemical...

Compound Q&A

What precautions should be taken when handling BODIPY-FL NHS ester (CAS: 146616-66-2)?

When handling BODIPY-FL NHS ester (CAS: 146616-66-2), it is important to wear personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...