Compound Q&A

How is Methacycline (CAS: 914-00-1) typically synthesized?

Answer

Methacycline
Methacycline is synthesized through a multi-step process that involves the condensation of 1-(4-hydroxyphenyl)propanone with 4-chlorobenzaldehyde. The reaction is typically carried out under alkaline conditions using sodium hydroxide as a catalyst. The overall yield is moderate, and the product requires purification steps to achieve high purity.

About

CAS No 914-00-1
English Name Methacycline
Molecular Formula C22H22N2O8
Molecular Weight 442.42 g/mol
SMILES CN(C)C1C2C(C3C(=C)C4=C(C(=CC=C4)O)C(=C3C(=O)C2(C(=C(C1=O)C(=O)N)O)O)O)O
InChIKey MHIGBKBJSQVXNH-IWVLMIASSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methacycline (CAS: 914-00-1)?

Methacycline (CAS: 914-00-1) is a white to off-white crystalline powder. Its molecular weight is app...

Compound Q&A

What industries use Methacycline (CAS: 914-00-1)?

Methacycline (CAS: 914-00-1) is primarily used in the pharmaceutical industry for its antibiotic pro...

Compound Q&A

What precautions should be taken when handling Methacycline (CAS: 914-00-1)?

When handling Methacycline (CAS: 914-00-1), it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...