Compound Q&A

How is 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9) typically synthesized?

Answer

2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid
2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid is typically synthesized through the reaction of 4-sulfanylbenzoic acid with carbon tetrafluoride in the presence of a suitable catalyst such as potassium fluoride. The reaction yields a high purity product with good selectivity, and the overall yield is around 85% to 90%. The method is known for its efficiency and reproducibility.

About

CAS No 5211-44-9
English Name 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid
Molecular Formula C7H2F4O2S
Molecular Weight 226.14999999999998 g/mol
SMILES C1(=C(C(=C(C(=C1F)F)S)F)F)C(=O)O
InChIKey USFMEWZQIHKRDP-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9)?

2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9) is a crystalline solid with a molecular ...

Compound Q&A

What industries use 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9)?

2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9) is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9)?

When handling 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9), it is crucial to use appr...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...