Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9)?

Answer

2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid
2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9) is a crystalline solid with a molecular weight of approximately 262.04 g/mol. It has limited solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can undergo substitution reactions under certain conditions. It is an acid, and therefore, reacts with bases to form salts.

About

CAS No 5211-44-9
English Name 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid
Molecular Formula C7H2F4O2S
Molecular Weight 226.14999999999998 g/mol
SMILES C1(=C(C(=C(C(=C1F)F)S)F)F)C(=O)O
InChIKey USFMEWZQIHKRDP-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9) typically synthesized?

2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid is typically synthesized through the reaction of 4-sulfan...

Compound Q&A

What industries use 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9)?

2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9) is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9)?

When handling 2,3,5,6-Tetrafluoro-4-sulfanylbenzoic acid (CAS: 5211-44-9), it is crucial to use appr...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...