Compound Q&A

What industries use 3-(Bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one (CAS: 1378390-29-4)?

Answer

3-(Bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one
This compound is used in the pharmaceutical and chemical industry for the synthesis of intermediates. It has applications in the production of dyes, pigments, and as a precursor in the development of new materials for sensors and semiconductors.

About

English Name 3-(Bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one
Molecular Formula C19H15BrO3
Molecular Weight 371.23 g/mol
SMILES BrCC(=O)c1ccc2c(c1)COc1c2cc2CCCC(=O)c2c1
InChIKey NEADWTKOYDYIHL-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one (CAS: 1378390-29-4)?

The compound is a crystalline solid with a molecular weight of approximately 348.05 g/mol. It has li...

Compound Q&A

How is 3-(Bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one (CAS: 1378390-29-4) typically synthesized?

It is commonly synthesized through the bromoacetylation of 10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H...

Compound Q&A

What precautions should be taken when handling 3-(Bromoacetyl)-10,11-dihydro-5H-dibenzo[c,g]chromen-8(9H)-one (CAS: 1378390-29-4)?

Handling this compound requires the use of appropriate personal protective equipment (PPE) including...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...