Compound Q&A

What are the physical and chemical properties of Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS: 881995-69-3)?

Answer

Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate
Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS: 881995-69-3) is a crystalline compound with a molecular weight of approximately 281.07 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and acetone. This compound is reactive, particularly with nucleophiles due to the amino group, and can undergo substitution reactions. It exhibits moderate reactivity in acidic and basic conditions.

About

English Name Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate
Molecular Formula C11H12F3NO2
Molecular Weight 247.21599999999998 g/mol
SMILES COC(=O)CC(CC1=CC(=C(C=C1F)F)F)N
InChIKey AWFWTEYDIPQVSG-SSDOTTSWSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS: 881995-69-3) typically synthesized?

Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS: 881995-69-3) is typically synthesized v...

Compound Q&A

What industries use Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS: 881995-69-3)?

Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS: 881995-69-3) is primarily used in the p...

Compound Q&A

What precautions should be taken when handling Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS: 881995-69-3)?

When handling Methyl (3r)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS: 881995-69-3), proper pers...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...