Compound Q&A

What precautions should be taken when handling Lorediplon (CAS: 917393-39-6)?

Answer

Lorediplon
When handling Lorediplon (CAS: 917393-39-6), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize exposure. Spills should be handled carefully, and the material safety data sheet (MSDS) should be consulted for detailed spill procedures. Ensure proper storage in a secure, dry, and cool place.

About

English Name Lorediplon
Molecular Formula C20H15FN4O2S
Molecular Weight 394.43 g/mol
SMILES CC(=O)N(C)C1=C(C=CC(=C1)C2=CC=NC3=C(C=NN23)C(=O)C4=CC=CS4)F
InChIKey NQPOCLFSADOXBR-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lorediplon (CAS: 917393-39-6)?

Lorediplon (CAS: 917393-39-6) is an organic compound with a crystalline form. Its molecular weight i...

Compound Q&A

How is Lorediplon (CAS: 917393-39-6) typically synthesized?

Lorediplon (CAS: 917393-39-6) is synthesized through a multi-step process involving the condensation...

Compound Q&A

What industries use Lorediplon (CAS: 917393-39-6)?

Lorediplon (CAS: 917393-39-6) is primarily used in the pharmaceutical industry for creating novel dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...