Compound Q&A

What precautions should be taken when handling 1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene (CAS: 39969-26-1)?

Answer

1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene
When handling 1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene, it is crucial to use appropriate personal protective equipment (PPE) such as safety goggles, gloves, and a lab coat. Always work in a well-ventilated area or a fume hood to minimize the risk of inhalation. Spills should be addressed immediately with appropriate absorbent materials, and the area should be cleaned thoroughly. Refer to the Safety Data Sheet (SDS) for detailed emergency procedures and storage recommendations.

About

CAS No 39969-26-1
English Name 1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene
Molecular Formula C18H18O
Molecular Weight 250.3 g/mol
SMILES CCCC1=CC=C(C=C1)C#CC2=CC=C(C=C2)OC
InChIKey NPCKVHHCQBJJIS-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene (CAS: 39969-26-1)?

1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene (CAS: 39969-26-1) typically synthesized?

1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene is typically synthesized via a coupling reaction involv...

Compound Q&A

What industries use 1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene (CAS: 39969-26-1)?

1-Methoxy-4-[(4-propylphenyl)ethynyl]benzene is primarily used in the pharmaceutical industry for th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...