Compound Q&A

What are the physical and chemical properties of 3,7-Dihydroxyflavone (CAS: 492-00-2)?

Answer

3,7-Dihydroxyflavone
3,7-Dihydroxyflavone (CAS: 492-00-2) is a yellow crystalline compound with a molecular weight of approximately 260.15 g/mol. It has a high solubility in polar solvents such as methanol and ethanol. Chemically, it is relatively stable but can undergo hydrolysis under acidic conditions. It is commonly used in natural product chemistry and biochemistry due to its antioxidant and anti-inflammatory properties.

About

CAS No 492-00-2
English Name 3,7-Dihydroxyflavone
Molecular Formula C15H10O4
Molecular Weight 254.24 g/mol
SMILES C1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O
InChIKey UWQJWDYDYIJWKY-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 3,7-Dihydroxyflavone (CAS: 492-00-2) typically synthesized?

3,7-Dihydroxyflavone (CAS: 492-00-2) is typically synthesized via the anthocyanidin pathway, involvi...

Compound Q&A

What industries use 3,7-Dihydroxyflavone (CAS: 492-00-2)?

3,7-Dihydroxyflavone (CAS: 492-00-2) is used in the pharmaceutical industry for its potential medici...

Compound Q&A

What precautions should be taken when handling 3,7-Dihydroxyflavone (CAS: 492-00-2)?

When handling 3,7-Dihydroxyflavone (CAS: 492-00-2), it is important to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...