Compound Q&A

What precautions should be taken when handling 1-Bromo-8-chlorodibenzo[b,d]furan (CAS: 2173554-83-9)?

Answer

1-Bromo-8-chlorodibenzo[b,d]furan
When handling 1-Bromo-8-chlorodibenzo[b,d]furan, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood. Spills should be cleaned up with care using absorbent materials, and the area should be thoroughly rinsed with water. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name 1-Bromo-8-chlorodibenzo[b,d]furan
Molecular Formula C12H6BrClO
Molecular Weight 281.54 g/mol
SMILES ClC1=CC2=C(OC3=C2C(Br)=CC=C3)C=C1
InChIKey LMGAQFSQAOXEDZ-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Bromo-8-chlorodibenzo[b,d]furan (CAS: 2173554-83-9)?

1-Bromo-8-chlorodibenzo[b,d]furan is a crystalline solid with a molecular weight of approximately 27...

Compound Q&A

How is 1-Bromo-8-chlorodibenzo[b,d]furan (CAS: 2173554-83-9) typically synthesized?

1-Bromo-8-chlorodibenzo[b,d]furan is typically synthesized via electrophilic aromatic substitution r...

Compound Q&A

What industries use 1-Bromo-8-chlorodibenzo[b,d]furan (CAS: 2173554-83-9)?

1-Bromo-8-chlorodibenzo[b,d]furan is used in the pharmaceutical industry for the synthesis of certai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...