Compound Q&A

What are the physical and chemical properties of Magnolignan (CAS: 93697-42-8)?

Answer

Magnolignan
Magnolignan (CAS: 93697-42-8) is a naturally occurring lignan. It is a white or off-white crystalline solid with a molecular weight of approximately 232.24 g/mol. Magnolignan is poorly soluble in water but soluble in organic solvents such as methanol and ethanol. It is relatively stable under neutral and acidic conditions but can degrade under basic conditions. Its reactivity is moderate, making it suitable for several chemical transformations.

About

CAS No 93697-42-8
English Name Magnolignan
Molecular Formula C18H20O4
Molecular Weight 300.35 g/mol
SMILES C=CCC1=C(C=CC(=C1)C2=C(C=CC(=C2)CC(CO)O)O)O
InChIKey LHJCLTLPXXKFTJ-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is Magnolignan (CAS: 93697-42-8) typically synthesized?

Magnolignan (CAS: 93697-42-8) can be synthesized through the condensation of trans-cinnamic acid wit...

Compound Q&A

What industries use Magnolignan (CAS: 93697-42-8)?

Magnolignan (CAS: 93697-42-8) is primarily used in the pharmaceutical industry for its potential ant...

Compound Q&A

What precautions should be taken when handling Magnolignan (CAS: 93697-42-8)?

When handling Magnolignan (CAS: 93697-42-8), it is important to use appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...