Compound Q&A

What is 2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one (CAS: 3569-82-2)?

Answer

2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one
2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one (CAS: 3569-82-2) is a xanthenone derivative. It has a molecular formula of C18H14O6 and exhibits characteristic UV-visible absorbance, which is useful in various analytical applications. The compound is characterized by its hydroxylation at specific positions, contributing to its unique spectroscopic and potential biological properties.

About

CAS No 3569-82-2
English Name 2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one
Molecular Formula C19H12O6
Molecular Weight 336.3 g/mol
SMILES C1=CC=C(C(=C1)C2=C3C=C(C(=O)C=C3OC4=CC(=C(C=C42)O)O)O)O
InChIKey GRWQEXZZWRVXDZ-UHFFFAOYSA-N
Last Updated: 2025-11-07 07:51

Related Q&A

Compound Q&A

What are the main uses of 2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one (CAS: 3569-82-2)?

2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one (CAS: 3569-82-2) is primarily used in the phar...

Compound Q&A

Is 2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one (CAS: 3569-82-2) safe?

2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one (CAS: 3569-82-2) is generally considered safe ...

Compound Q&A

How should 2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one (CAS: 3569-82-2) be stored?

2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one (CAS: 3569-82-2) should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...