Compound Q&A

What are the main uses of 2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine (CAS: 1073062-42-6)?

Answer

2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine
2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine is primarily used in the synthesis of other organic compounds, particularly in the pharmaceutical and agrochemical industries. It serves as a key intermediate in the production of drugs and herbicides due to its functional groups and aromatic moieties.

About

English Name 2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine
Molecular Formula C21H13BrClN3
Molecular Weight 422.71 g/mol
SMILES Clc1cc(Br)cc(c1)c1nc(nc(n1)c1ccccc1)c1ccccc1
InChIKey BLKKWMCDZNDYEQ-UHFFFAOYSA-N
Last Updated: 2025-11-07 07:51

Related Q&A

Compound Q&A

What is 2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine (CAS: 1073062-42-6)?

2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine is a complex triazine derivative with a molec...

Compound Q&A

Is 2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine (CAS: 1073062-42-6) safe?

2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine is generally considered safe when handled wit...

Compound Q&A

How should 2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine (CAS: 1073062-42-6) be stored?

2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...