Compound Q&A

Is 1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene (CAS: 21956-56-9) safe?

Answer

1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene
1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene is generally considered safe under normal handling conditions. However, it should be handled with appropriate personal protective equipment (PPE) such as gloves and goggles. Storage and disposal should follow local regulations and safety guidelines to minimize environmental impact.

About

CAS No 21956-56-9
English Name 1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene
Molecular Formula C16H16O2
Molecular Weight 240.3 g/mol
SMILES COc1cc(/C=C/c2ccccc2)cc(c1)OC
InChIKey BIYGTLDPTJMNET-CMDGGOBGSA-N
Last Updated: 2025-11-07 07:51

Related Q&A

Compound Q&A

What is 1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene (CAS: 21956-56-9)?

1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene is an organic compound with the CAS number 21956-56-9. It...

Compound Q&A

What are the main uses of 1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene (CAS: 21956-56-9)?

1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene is primarily used as a precursor in the synthesis of othe...

Compound Q&A

How should 1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene (CAS: 21956-56-9) be stored?

1,3-Dimethoxy-5-[(E)-2-phenylvinyl]benzene should be stored in a cool, dry place, away from direct s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...