Compound Q&A

How should (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid (CAS: 108999-93-5) be stored?

Answer

(1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid
This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It is best kept in a tightly sealed container to prevent degradation or reaction with environmental moisture or air. Refrigeration is not typically necessary unless specified by the manufacturer.

About

English Name (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid
Molecular Formula C11H17NO4
Molecular Weight 227.26 g/mol
SMILES CC(C)(C)OC(=O)NC1CC(C=C1)C(=O)O
InChIKey WOUNTSATDZJBLP-JGVFFNPUSA-N
Last Updated: 2025-11-06 18:48

Related Q&A

Compound Q&A

What is (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid (CAS: 108999-93-5)?

This compound is a specific carboxylic acid derivative with a complex cyclic structure. It is charac...

Compound Q&A

What are the main uses of (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid (CAS: 108999-93-5)?

This compound is primarily used as an intermediate in the synthesis of pharmaceuticals and other org...

Compound Q&A

Is (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid (CAS: 108999-93-5) safe?

This compound is generally safe when handled with appropriate precautions. However, it should be use...

Compound Q&A

What are the main uses of 1H-Indazole-6-carbonitrile (CAS: 141290-59-7)?

1H-Indazole-6-carbonitrile finds applications in pharmaceuticals, where it serve...

141290-59-71H-Indazole-6-carbon...
Compound Q&A

How should waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) be handled?

Waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) should be collecte...

2997-85-5Dioctyl (2E)-2-buten...
Compound Q&A

What industries use Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide (CAS: 68291-98-5)?

Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide is primarily used in pharmac...

68291-98-5Sodium [(1,2-benzoxa...
Compound Q&A

Are there alternatives to Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxylate (CAS: 741709-66-0) in synthesis?

Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxyla...

741709-66-0Dimethyl 4-(4,4,5,5-...