Compound Q&A

What are the main uses of (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid (CAS: 108999-93-5)?

Answer

(1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid
This compound is primarily used as an intermediate in the synthesis of pharmaceuticals and other organic compounds. It is also valuable in research for studying organic reactions and molecular interactions due to its unique structural features.

About

English Name (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid
Molecular Formula C11H17NO4
Molecular Weight 227.26 g/mol
SMILES CC(C)(C)OC(=O)NC1CC(C=C1)C(=O)O
InChIKey WOUNTSATDZJBLP-JGVFFNPUSA-N
Last Updated: 2025-11-06 18:48

Related Q&A

Compound Q&A

What is (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid (CAS: 108999-93-5)?

This compound is a specific carboxylic acid derivative with a complex cyclic structure. It is charac...

Compound Q&A

Is (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid (CAS: 108999-93-5) safe?

This compound is generally safe when handled with appropriate precautions. However, it should be use...

Compound Q&A

How should (1R,4S)-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-2-cyclopentene-1-carboxylic acid (CAS: 108999-93-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It i...

Compound Q&A

What are the main uses of 1H-Indazole-6-carbonitrile (CAS: 141290-59-7)?

1H-Indazole-6-carbonitrile finds applications in pharmaceuticals, where it serve...

141290-59-71H-Indazole-6-carbon...
Compound Q&A

How should waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) be handled?

Waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) should be collecte...

2997-85-5Dioctyl (2E)-2-buten...
Compound Q&A

What industries use Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide (CAS: 68291-98-5)?

Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide is primarily used in pharmac...

68291-98-5Sodium [(1,2-benzoxa...
Compound Q&A

Are there alternatives to Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxylate (CAS: 741709-66-0) in synthesis?

Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxyla...

741709-66-0Dimethyl 4-(4,4,5,5-...