Compound Q&A

What is 2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine (CAS: 260447-04-9)?

Answer

2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine
2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine (CAS: 260447-04-9) is a heterocyclic organic compound with a morpholine ring fused to a pyridine ring, containing nitro and methyl substituents. This molecule is characterized by its aromaticity and nitrogen-containing heterocycle, making it useful in medicinal chemistry and as an intermediate in organic synthesis.

About

English Name 2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine
Molecular Formula C11H15N3O3
Molecular Weight 237.26 g/mol
SMILES CC1CN(CC(O1)C)C2=NC=C(C=C2)[N+](=O)[O-]
InChIKey OEWWQMFPALMWEF-UHFFFAOYSA-N
Last Updated: 2025-11-06 18:48

Related Q&A

Compound Q&A

What are the main uses of 2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine (CAS: 260447-04-9)?

2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine (CAS: 260447-04-9) is primarily used as a pharmaceuti...

Compound Q&A

Is 2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine (CAS: 260447-04-9) safe?

2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine (CAS: 260447-04-9) is generally considered safe under...

Compound Q&A

How should 2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine (CAS: 260447-04-9) be stored?

2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine (CAS: 260447-04-9) should be stored under nitrogen at...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...