Compound Q&A

What is 2,2-Bis[(benzoyloxy)methyl]butyl benzoate (CAS: 54547-34-1)?

Answer

2,2-Bis[(benzoyloxy)methyl]butyl benzoate
2,2-Bis[(benzoyloxy)methyl]butyl benzoate is a chemical compound with the CAS number 54547-34-1. It is a lipid-soluble compound with a molecular formula of C24H34O6. This compound is known for its stability and is used in various applications such as pharmaceuticals and cosmetics.

About

CAS No 54547-34-1
English Name 2,2-Bis[(benzoyloxy)methyl]butyl benzoate
Molecular Formula C27H26O6
Molecular Weight 446.5 g/mol
EINECS 927-700-7
SMILES O=C(OCC(CC)(COC(=O)c1ccccc1)COC(=O)c2ccccc2)c3ccccc3
InChIKey OWVAEQAOZDETGQ-UHFFFAOYSA-N
Last Updated: 2025-11-06 18:48

Related Q&A

Compound Q&A

What are the main uses of 2,2-Bis[(benzoyloxy)methyl]butyl benzoate (CAS: 54547-34-1)?

2,2-Bis[(benzoyloxy)methyl]butyl benzoate is primarily used in the pharmaceutical industry as a stab...

Compound Q&A

Is 2,2-Bis[(benzoyloxy)methyl]butyl benzoate (CAS: 54547-34-1) safe?

2,2-Bis[(benzoyloxy)methyl]butyl benzoate is considered safe for use in pharmaceuticals and cosmetic...

Compound Q&A

How should 2,2-Bis[(benzoyloxy)methyl]butyl benzoate (CAS: 54547-34-1) be stored?

2,2-Bis[(benzoyloxy)methyl]butyl benzoate should be stored in a cool, dry place away from direct sun...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...