Compound Q&A

What is 2,2'-dimethyl-4,4'-biphenyldicarboxylic acid (CAS: 117490-52-5)?

Answer

2,2'-dimethyl-4,4'-biphenyldicarboxylic acid
2,2'-Dimethyl-4,4'-biphenyldicarboxylic acid is a derivative of biphenyl with carboxylic acid groups attached at the 4 positions. It has a molecular formula of C18H14O4 and is characterized by its stability and chemical reactivity. It is used in the synthesis of dyes, pigments, and other organic compounds.

About

English Name 2,2'-dimethyl-4,4'-biphenyldicarboxylic acid
Molecular Formula C16H14O4
Molecular Weight 270.28 g/mol
SMILES Cc1cc(ccc1c1ccc(cc1C)C(=O)O)C(=O)O
InChIKey VUYFKAXNJXFNFA-UHFFFAOYSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What are the main uses of 2,2'-dimethyl-4,4'-biphenyldicarboxylic acid (CAS: 117490-52-5)?

2,2'-Dimethyl-4,4'-biphenyldicarboxylic acid is primarily used in the production of dyes and pigment...

Compound Q&A

Is 2,2'-dimethyl-4,4'-biphenyldicarboxylic acid (CAS: 117490-52-5) safe?

2,2'-Dimethyl-4,4'-biphenyldicarboxylic acid is generally considered safe for industrial use when ap...

Compound Q&A

How should 2,2'-dimethyl-4,4'-biphenyldicarboxylic acid (CAS: 117490-52-5) be stored?

2,2'-Dimethyl-4,4'-biphenyldicarboxylic acid should be stored in a cool, dry place away from direct ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...