Compound Q&A

What is (3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid (CAS: 765895-65-6)?

Answer

(3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid
(3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid, also known as mCPPA, is a chemical compound with the CAS number 765895-65-6. It is an amino acid derivative characterized by its chiral center, and it has a molecular formula of C11H15NO3. This compound is commonly used in pharmaceutical research due to its structural similarities to other important compounds.

About

English Name (3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid
Molecular Formula C10H13NO3
Molecular Weight 195.21 g/mol
SMILES COC1=CC=CC(=C1)C(CC(=O)O)N
InChIKey FGMPGCPZEOXEES-SECBINFHSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What are the main uses of (3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid (CAS: 765895-65-6)?

(3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid is primarily used in pharmaceutical research as a pre...

Compound Q&A

Is (3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid (CAS: 765895-65-6) safe?

The safety of (3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid depends on the context of its use. Gene...

Compound Q&A

How should (3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid (CAS: 765895-65-6) be stored?

(3R)-3-Amino-3-(3-methoxyphenyl)propanoic acid should be stored in a tightly sealed container in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...