Compound Q&A

What are the main uses of 4-Hydroxy-3-methylphenyl beta-D-glucopyranoside (CAS: 25712-94-1)?

Answer

4-Hydroxy-3-methylphenyl beta-D-glucopyranoside
4-Hydroxy-3-methylphenyl beta-D-glucopyranoside is primarily used in the pharmaceutical industry as a potential bioactive compound for medicinal research. It can also be utilized in food applications for its potential health benefits and as a natural food additive. Additionally, it may serve as a model compound for scientific research due to its unique chemical structure.

About

CAS No 25712-94-1
English Name 4-Hydroxy-3-methylphenyl beta-D-glucopyranoside
Molecular Formula C13H18O7
Molecular Weight 286.28 g/mol
SMILES CC1=C(C=CC(=C1)OC2C(C(C(C(O2)CO)O)O)O)O
InChIKey SUSHDSMGFVANCQ-UJPOAAIJSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What is 4-Hydroxy-3-methylphenyl beta-D-glucopyranoside (CAS: 25712-94-1)?

4-Hydroxy-3-methylphenyl beta-D-glucopyranoside is a complex organic compound with the CAS number 25...

Compound Q&A

Is 4-Hydroxy-3-methylphenyl beta-D-glucopyranoside (CAS: 25712-94-1) safe?

4-Hydroxy-3-methylphenyl beta-D-glucopyranoside is considered safe for use in the pharmaceutical and...

Compound Q&A

How should 4-Hydroxy-3-methylphenyl beta-D-glucopyranoside (CAS: 25712-94-1) be stored?

4-Hydroxy-3-methylphenyl beta-D-glucopyranoside should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...