Compound Q&A

What are the main uses of 6-Acetamidonicotinic acid (CAS: 21550-48-1)?

Answer

6-Acetamidonicotinic acid
6-Acetamidonicotinic acid is primarily used in the pharmaceutical industry as an intermediate for the synthesis of certain drugs. It also finds applications in research, particularly in the development of novel compounds and as a reagent in chemical reactions.

About

CAS No 21550-48-1
English Name 6-Acetamidonicotinic acid
Molecular Formula C8H8N2O3
Molecular Weight 180.16 g/mol
SMILES CC(=O)NC1=NC=C(C=C1)C(=O)O
InChIKey RXSLHYTZMIUANX-UHFFFAOYSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What is 6-Acetamidonicotinic acid (CAS: 21550-48-1)?

6-Acetamidonicotinic acid is an organic compound with the CAS number 21550-48-1. It is a white cryst...

Compound Q&A

Is 6-Acetamidonicotinic acid (CAS: 21550-48-1) safe?

6-Acetamidonicotinic acid is generally considered safe for laboratory use when handled with proper p...

Compound Q&A

How should 6-Acetamidonicotinic acid (CAS: 21550-48-1) be stored?

6-Acetamidonicotinic acid should be stored in a cool, dry, and shaded area to prevent degradation. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...