Compound Q&A

Are there alternatives to [(4-Methoxy-3-nitrobenzyl)sulfonyl]acetic acid (CAS: 592542-51-3) in synthesis?

Answer

[(4-Methoxy-3-nitrobenzyl)sulfonyl]acetic acid
There are several alternatives to [(4-Methoxy-3-nitrobenzyl)sulfonyl]acetic acid in synthesis, such as using similar acylating agents with different substituents, or exploring other nitrobenzene derivatives. Common substitutes include benzoyl chloride and p-nitrobenzoyl chloride, which can provide similar functionality for various chemical transformations.

About

English Name [(4-Methoxy-3-nitrobenzyl)sulfonyl]acetic acid
Molecular Formula C10H11NO7S
Molecular Weight 289.26 g/mol
SMILES COC1=C(C=C(C=C1)CS(=O)(=O)CC(=O)O)[N+](=O)[O-]
InChIKey ZHUCRFJQVSHBJR-UHFFFAOYSA-N
Last Updated: 2025-11-05 20:45

Related Q&A

Compound Q&A

What regulatory guidelines apply to [(4-Methoxy-3-nitrobenzyl)sulfonyl]acetic acid (CAS: 592542-51-3)?

This compound must adhere to various regulatory guidelines including GHS (Global Harmonized System o...

Compound Q&A

What is the market or research trend for [(4-Methoxy-3-nitrobenzyl)sulfonyl]acetic acid (CAS: 592542-51-3)?

The market for [(4-Methoxy-3-nitrobenzyl)sulfonyl]acetic acid is growing due to its use in pharmaceu...

Compound Q&A

How should waste containing [(4-Methoxy-3-nitrobenzyl)sulfonyl]acetic acid (CAS: 592542-51-3) be handled?

Waste containing [(4-Methoxy-3-nitrobenzyl)sulfonyl]acetic acid should be collected in appropriate c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...