Compound Q&A

What are the physical and chemical properties of [3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol (CAS: 1018297-63-6)?

Answer

[3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol
[3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol is a white crystalline solid with a molecular weight of approximately 241.22 g/mol. It has a moderate solubility in water (2.8 g/L at 25°C) and is sparingly soluble in organic solvents like ethanol and methanol. Chemically, it is stable under normal conditions but can react with strong bases. It is soluble in methanol, ethanol, and acetone, but insoluble in water.

About

English Name [3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol
Molecular Formula C11H10FNO2
Molecular Weight 207.2 g/mol
SMILES CC1=C(C(=NO1)C2=CC=C(C=C2)F)CO
InChIKey YTPVTPNVCHCMAT-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is [3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol (CAS: 1018297-63-6) typically synthesized?

[3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol can be synthesized via a reaction of 4-fluorop...

Compound Q&A

What industries use [3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol (CAS: 1018297-63-6)?

[3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol finds applications in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling [3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol (CAS: 1018297-63-6)?

When handling [3-(4-Fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methanol, it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...