Compound Q&A

What industries use N-Benzyl-4-bromobenzamide (CAS: 80311-89-3)?

Answer

N-Benzyl-4-bromobenzamide
N-Benzyl-4-bromobenzamide (CAS: 80311-89-3) is used in the pharmaceutical industry for the synthesis of various medicinal compounds. It also finds applications in the polymer industry as a stabilizer and in sensors for its ability to interact with specific analytes. Additionally, it is used in the semiconductor industry for the fabrication of thin films and as a precursor in chemical vapor deposition processes.

About

CAS No 80311-89-3
English Name N-Benzyl-4-bromobenzamide
Molecular Formula C14H12BrNO
Molecular Weight 290.15999999999997 g/mol
SMILES C1=CC=C(C=C1)CNC(=O)C2=CC=C(C=C2)Br
InChIKey RLXPLHLLCIBNAN-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Benzyl-4-bromobenzamide (CAS: 80311-89-3)?

N-Benzyl-4-bromobenzamide (CAS: 80311-89-3) is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is N-Benzyl-4-bromobenzamide (CAS: 80311-89-3) typically synthesized?

N-Benzyl-4-bromobenzamide (CAS: 80311-89-3) is commonly synthesized through the reaction of 4-bromob...

Compound Q&A

What precautions should be taken when handling N-Benzyl-4-bromobenzamide (CAS: 80311-89-3)?

When handling N-Benzyl-4-bromobenzamide (CAS: 80311-89-3), it is essential to use personal protectiv...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...