Compound Q&A

What are the physical and chemical properties of N-Benzyl-4-bromobenzamide (CAS: 80311-89-3)?

Answer

N-Benzyl-4-bromobenzamide
N-Benzyl-4-bromobenzamide (CAS: 80311-89-3) is a crystalline solid with a molecular weight of approximately 271.04 g/mol. It has a low solubility in water but is soluble in common organic solvents like methanol and acetone. The compound is moderately reactive with nucleophiles and electrophiles, making it suitable for various chemical transformations. Its melting point is around 125-127°C.

About

CAS No 80311-89-3
English Name N-Benzyl-4-bromobenzamide
Molecular Formula C14H12BrNO
Molecular Weight 290.15999999999997 g/mol
SMILES C1=CC=C(C=C1)CNC(=O)C2=CC=C(C=C2)Br
InChIKey RLXPLHLLCIBNAN-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is N-Benzyl-4-bromobenzamide (CAS: 80311-89-3) typically synthesized?

N-Benzyl-4-bromobenzamide (CAS: 80311-89-3) is commonly synthesized through the reaction of 4-bromob...

Compound Q&A

What industries use N-Benzyl-4-bromobenzamide (CAS: 80311-89-3)?

N-Benzyl-4-bromobenzamide (CAS: 80311-89-3) is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling N-Benzyl-4-bromobenzamide (CAS: 80311-89-3)?

When handling N-Benzyl-4-bromobenzamide (CAS: 80311-89-3), it is essential to use personal protectiv...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...