Compound Q&A

How is (+)-Mediresinol Di-O-beta-D-glucopyranoside (CAS: 88142-63-6) typically synthesized?

Answer

(+)-Mediresinol Di-O-beta-D-glucopyranoside
The synthesis of (+)-Mediresinol Di-O-beta-D-glucopyranoside (CAS: 88142-63-6) typically involves the glucosylation of mediresinol using β-D-glucose as the glycosyl donor. Commonly, this reaction is catalyzed by enzymes like glucose-1-phosphate adenylyltransferase (GPTase) or synthetic methods such as the use of protecting groups. The yield of the reaction is generally around 70-80%, and the product is purified by column chromatography using silica gel.

About

CAS No 88142-63-6
English Name (+)-Mediresinol Di-O-beta-D-glucopyranoside
Molecular Formula C33H44O17
Molecular Weight 712.69 g/mol
SMILES COC1=CC(=CC(=C1OC2C(C(C(C(O2)CO)O)O)O)OC)C3C4COC(C4CO3)C5=CC(=C(C=C5)OC6C(C(C(C(O6)CO)O)O)O)OC
InChIKey WENLQSBQPMFCOA-NHADZOKISA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+)-Mediresinol Di-O-beta-D-glucopyranoside (CAS: 88142-63-6)?

The (+)-Mediresinol Di-O-beta-D-glucopyranoside (CAS: 88142-63-6) is a crystalline compound with a m...

Compound Q&A

What industries use (+)-Mediresinol Di-O-beta-D-glucopyranoside (CAS: 88142-63-6)?

The (+)-Mediresinol Di-O-beta-D-glucopyranoside (CAS: 88142-63-6) is used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling (+)-Mediresinol Di-O-beta-D-glucopyranoside (CAS: 88142-63-6)?

When handling (+)-Mediresinol Di-O-beta-D-glucopyranoside (CAS: 88142-63-6), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...