Compound Q&A

How is 4-Ethoxy-1,2-benzenediamine sulfate (1:1) (CAS: 85137-09-3) typically synthesized?

Answer

4-Ethoxy-1,2-benzenediamine sulfate (1:1)
4-Ethoxy-1,2-benzenediamine sulfate (1:1) (CAS: 85137-09-3) is typically synthesized by reacting 4-ethoxyaniline with sulfuric acid in the presence of a suitable catalyst such as pyridine. The process involves a diazotization step followed by alkylation, leading to a high yield of the target compound. The reaction is selective and has good reproducibility.

About

CAS No 85137-09-3
English Name 4-Ethoxy-1,2-benzenediamine sulfate (1:1)
Molecular Formula C8H14N2O5S
Molecular Weight 250.28 g/mol
SMILES CCOC1=CC(=C(C=C1)N)N.OS(=O)(=O)O
InChIKey AOWLQOMCVRWFEA-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Ethoxy-1,2-benzenediamine sulfate (1:1) (CAS: 85137-09-3)?

4-Ethoxy-1,2-benzenediamine sulfate (1:1) (CAS: 85137-09-3) is a crystalline solid with a molecular ...

Compound Q&A

What industries use 4-Ethoxy-1,2-benzenediamine sulfate (1:1) (CAS: 85137-09-3)?

4-Ethoxy-1,2-benzenediamine sulfate (1:1) (CAS: 85137-09-3) is used in the pharmaceutical and dye in...

Compound Q&A

What precautions should be taken when handling 4-Ethoxy-1,2-benzenediamine sulfate (1:1) (CAS: 85137-09-3)?

When handling 4-Ethoxy-1,2-benzenediamine sulfate (1:1) (CAS: 85137-09-3), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...