Compound Q&A

What precautions should be taken when handling 6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione (CAS: 89073-60-9)?

Answer

6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione
When handling 6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be stored in a cool, dry place away from moisture and heat sources. Due to its reactivity, it should be handled in a well-ventilated area or under a fume hood. In case of a spill, it is advisable to use appropriate spill kits and follow the safety data sheet (SDS) guidelines for disposal.

About

CAS No 89073-60-9
English Name 6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione
Molecular Formula C8H12N4O3
Molecular Weight 212.21 g/mol
SMILES CCN1C(=C(C(=O)N(C1=O)CC)N=O)N
InChIKey GAZDRRFBKXZFCM-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione (CAS: 89073-60-9)?

6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione has a crystalline form and a molecular weig...

Compound Q&A

How is 6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione (CAS: 89073-60-9) typically synthesized?

6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione is typically synthesized through a multi-st...

Compound Q&A

What industries use 6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione (CAS: 89073-60-9)?

6-Amino-1,3-diethyl-5-nitrosopyrimidine-2,4(1H,3H)-dione is primarily used in the pharmaceutical ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...