Compound Q&A

What industries use Neoisoliquiritine (CAS: 59122-93-9)?

Answer

Neoisoliquiritine
Neoisoliquiritine (CAS: 59122-93-9) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various bioactive compounds. It is also explored for use in the food industry as a flavor enhancer, particularly in beverages and confectionery. Additionally, it has potential applications in the cosmetic industry for its potential anti-inflammatory and antioxidant properties.

About

CAS No 59122-93-9
English Name Neoisoliquiritine
Molecular Formula C21H22O9
Molecular Weight 418.4 g/mol
SMILES C1=CC(=CC=C1C=CC(=O)C2=C(C=C(C=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O
InChIKey XQWFHGOIUZFQPJ-LXGDFETPSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Neoisoliquiritine (CAS: 59122-93-9)?

Neoisoliquiritine (CAS: 59122-93-9) is a white or off-white crystalline powder. It has a molecular w...

Compound Q&A

How is Neoisoliquiritine (CAS: 59122-93-9) typically synthesized?

Neoisoliquiritine (CAS: 59122-93-9) can be synthesized by the reduction of isoliquiritigenin with hy...

Compound Q&A

What precautions should be taken when handling Neoisoliquiritine (CAS: 59122-93-9)?

When handling Neoisoliquiritine (CAS: 59122-93-9), it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...