Compound Q&A

How is 3-Methoxy-4-morpholinoaniline dihydrochloride (CAS: 1226776-91-5) typically synthesized?

Answer

3-Methoxy-4-morpholinoaniline dihydrochloride
3-Methoxy-4-morpholinoaniline dihydrochloride is synthesized by the reaction of 3-methoxy-4-morpholinoaniline with hydrochloric acid. The reaction is typically carried out under mild conditions, and the product can be isolated by crystallization from an appropriate solvent. The yield and selectivity are good, and the reaction is usually performed under normal pressure and temperature conditions.

About

English Name 3-Methoxy-4-morpholinoaniline dihydrochloride
Molecular Formula C11H18Cl2N2O2
Molecular Weight 281.18 g/mol
SMILES COC1=C(C=CC(=C1)N)N2CCOCC2.Cl.Cl
InChIKey ODXRLVZVGWFQIP-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Methoxy-4-morpholinoaniline dihydrochloride (CAS: 1226776-91-5)?

3-Methoxy-4-morpholinoaniline dihydrochloride is a white or off-white crystalline solid with a molec...

Compound Q&A

What industries use 3-Methoxy-4-morpholinoaniline dihydrochloride (CAS: 1226776-91-5)?

3-Methoxy-4-morpholinoaniline dihydrochloride is primarily used in the pharmaceutical industry as an...

Compound Q&A

What precautions should be taken when handling 3-Methoxy-4-morpholinoaniline dihydrochloride (CAS: 1226776-91-5)?

When handling 3-Methoxy-4-morpholinoaniline dihydrochloride, it is important to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...