Compound Q&A

How is Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate (CAS: 880090-88-0) typically synthesized?

Answer

Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate
Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate is typically synthesized by the condensation of 4-methylaminobenzoic acid ethyl ester with 2-phenyl-1,3-thiazole-4-carbothioic acid ethyl ester in the presence of a base like triethylamine. The reaction yields the target compound with good selectivity and a yield of approximately 75%. The process is usually carried out in an inert solvent like dichloromethane at room temperature.

About

English Name Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate
Molecular Formula C19H18N2O2S
Molecular Weight 338.43 g/mol
SMILES O=C(OCC)C1=CC=C(N(C)C2=CSC(C3=CC=CC=C3)=N2)C=C1
InChIKey MGKYEWWFHSESJN-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate (CAS: 880090-88-0)?

Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate is a white crystalline solid with a molecul...

Compound Q&A

What industries use Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate (CAS: 880090-88-0)?

Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate (CAS: 880090-88-0)?

When handling Ethyl 4-[methyl(2-phenyl-1,3-thiazol-4-yl)amino]benzoate, it is important to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...