Compound Q&A

What industries use 2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one (CAS: 3158-91-6)?

Answer

2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one
2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one is used in the pharmaceutical industry for the synthesis of various bioactive compounds. It also finds applications in the polymer and semiconductor industries, where its unique chemical properties make it useful as a precursor or intermediate.

About

CAS No 3158-91-6
English Name 2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one
Molecular Formula C13H8ClNO2
Molecular Weight 245.67 g/mol
SMILES C1=CC=C2C(=C1)NC(=O)C3=C(O2)C=CC(=C3)Cl
InChIKey ZAGINEPNYIZLLO-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one (CAS: 3158-91-6)?

2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one (CAS: 3158-91-6) is a crystalline solid with a molecul...

Compound Q&A

How is 2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one (CAS: 3158-91-6) typically synthesized?

2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one is typically synthesized via the condensation of 2-chl...

Compound Q&A

What precautions should be taken when handling 2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one (CAS: 3158-91-6)?

When handling 2-Chlorodibenzo[b,f][1,4]oxazepin-11(10H)-one (CAS: 3158-91-6), it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...